| Identification | |
| Name: | 2-Propenoic acid,(3-methoxyphenyl)methyl ester |
| Synonyms: | P-MethoxylCinnamaldehydeIsooctyl;p-Methoxyl;P-MethoxylMethylCinnamate;methyl p-methoxycinnamate;4-methoxycinnamic acid methyl ester;3-(4-Methoxyphenyl)-2-propenoic acid methyl ester; |
| CAS: | 144261-46-1 |
| Molecular Formula: | C11H12O3 |
| Molecular Weight: | 192.21 |
| InChI: | InChI=1/C11H12O3/c1-3-11(12)14-8-9-5-4-6-10(7-9)13-2/h3-7H,1,8H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.08 |
| Refractive index: | 1.51 |
| Specification: |
? 2-Propenoic acid,(3-methoxyphenyl)methyl ester , with CAS number of 144261-46-1, can be called 3-(4-Methoxyphenyl)-2-propenoic acid methyl ester ; 4-methoxycinnamic acid methyl ester ; methyl p-methoxycinnamate ; methyl 4-methoxycinnamate ; P-MethoxylMethylCinnamate ; P-MethoxylCinnamaldehydeIsooctyl;p-Methoxyl . |
| Safety Data | |
 |
|
