| Identification | |
| Name: | 2,3,4-trifluorobenzyl alcohol |
| Synonyms: | - |
| CAS: | 144284-24-2 |
| EINECS: | -0 |
| Molecular Formula: | C7H5F3O |
| Molecular Weight: | 162.11 |
| InChI: | InChI=1/C7H5F3O/c8-5-2-1-4(3-11)6(9)7(5)10/h1-2,11H,3H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 53.9°C |
| Boiling Point: | 155.5°Cat760mmHg |
| Density: | 1.285g/cm3 |
| Refractive index: | 1.47 |
| Specification: |
2,3,4-Trifluorobenzyl alcohol , its cas register number is 144284-24-2. It also can be called 2,3,4-Trifluorobenzenemethanol ; and Benzenemethanol, 2,3,4-trifluoro- . |
| Flash Point: | 53.9°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
