| Identification | |
| Name: | Propanedioic acid,2-ethyl-2-phenyl-, 1-[2-(diethylamino)ethyl] 3-ethyl ester |
| Synonyms: | Malonicacid, ethylphenyl-, 2-(diethylamino)ethyl ethyl ester (6CI,7CI,8CI); Propanedioicacid, ethylphenyl-, 2-(diethylamino)ethyl ethyl ester (9CI); PHEM; Sch 5705 |
| CAS: | 14436-50-1 |
| Molecular Formula: | C19H29 N O4 |
| Molecular Weight: | 335.49 |
| InChI: | InChI=1/C19H29NO4/c1-4-20(5-2)14-15-24-19(22)17(18(21)23-6-3)13-12-16-10-8-7-9-11-16/h7-11,17H,4-6,12-15H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 210.5°C |
| Boiling Point: | 424.4°Cat760mmHg |
| Density: | 1.053g/cm3 |
| Refractive index: | 1.502 |
| Specification: |
Malonic acid,ethylphenyl-,2-(diethylamino)ethyl ethyl ester ,its cas register number is 14436-50-1. It also can be called PHEM ; Phenylaethylmalonsaeure-aethyl-diaethylaminoaethyl-di-ester and Malonicacid,ethylphenyl-,2-(diethylamino)ethyl ethyl ester . |
| Flash Point: | 210.5°C |
| Safety Data | |
 |
|
