| Identification | |
| Name: | Phthalhydrazide |
| Synonyms: | Phthalic acid cyclic hydrazide;1,2-Benzenedicarboxylicacid, cyclic hydrazide;1,4-Phthalazinediol;2,3-Dihydro-1,4-phthalazinedione;Hydrazine,1,2-(1,2-phenylenedicarbonyl)-;Phthalazine-1,4(2H,3H)-dione; |
| CAS: | 1445-69-8 |
| EINECS: | 215-893-4 |
| Molecular Formula: | C8H6N2O2 |
| Molecular Weight: | 162.15 |
| InChI: | InChI=1/C8H6N2O2/c11-7-5-3-1-2-4-6(5)8(12)10-9-7/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 270.4 ºC |
| Boiling Point: | 523.5 ºC at 760 mmHg |
| Density: | 1.336 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.586 |
| Appearance: | white powder and chunks |
| Specification: |
Phthalhydrazide (CAS NO.1445-69-8), its Synonyms are 2,3-Dihydro-1,4-phthalazinedione ; 1,4-Phthalazinediol ; N,N'-Phthaloylhydrazine ; Phthalic acid cyclic hydrazide ; Phthalocyclohydrazide . |
| Flash Point: | 270.4 ºC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
 |
|
