| Identification |
| Name: | Propanoic acid,3-hydroxy-, phenylmethyl ester |
| Synonyms: | Hydracrylicacid, benzyl ester (8CI); Benzyl 3-hydroxypropanoate; Benzyl3-hydroxypropionate |
| CAS: | 14464-10-9 |
| EINECS: | 238-453-3 |
| Molecular Formula: | C10H12 O3 |
| Molecular Weight: | 180.20048 |
| InChI: | InChI=1/C10H12O3/c11-7-6-10(12)13-8-9-4-2-1-3-5-9/h1-5,11H,6-8H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 136.5°C |
| Boiling Point: | 315.5°C at 760 mmHg |
| Density: | 1.153g/cm3 |
| Refractive index: | 1.531 |
| Flash Point: | 136.5°C |
| Usage: | Intermediate in the production of Cyclophosphamide metabolites. |
| Safety Data |
| |
 |
