| Identification | |
| Name: | 2-Morpholinone,5-phenyl-, (5S)- |
| Synonyms: | 2-Morpholinone,5-phenyl-, (S)-;(5S)-5-Phenylmorpholin-2-one;(5S)-5-Phenylmorpholin-2-on;(5S)-3,4,5,6-Tetrahydro-5-phenyl-4(H)-1,4-oxazin-2-one;(S)-5-Phenylmorpholin-2-one;(S)-5-Phenyl-morpholin-2-one; |
| CAS: | 144896-92-4 |
| Molecular Formula: | C10H11NO2 |
| Molecular Weight: | 177.2 |
| InChI: | InChI=1/C10H11NO2/c12-10-6-11-9(7-13-10)8-4-2-1-3-5-8/h1-5,9,11H,6-7H2/t9-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 174.1°C |
| Boiling Point: | 364.3°Cat760mmHg |
| Density: | 1.149g/cm3 |
| Refractive index: | 1.535 |
| Specification: |
The (S)-5-Phenylmorpholin-2-one, with the cas registry number 144896-92-4, is also called (5S)-3,4,5,6-Tetrahydro-5-phenyl-4(H)-1,4-oxazin-2-one. And the molecular formula of the chemical is C10H11NO2. The characteristics of this chemical are as followings: (1)ACD/LogP: 0.64; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1; (4)ACD/LogD (pH 7.4): 0; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 5; (8)ACD/KOC (pH 7.4): 27; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 38.33 Å2; (13)Index of Refraction: 1.535; (14)Molar Refractivity: 47.975 cm3; (15)Molar Volume: 154.212 cm3; (16)Polarizability: 19.019×10-24cm3; (17)Surface Tension: 39.302 dyne/cm; (18)Density: 1.149 g/cm3; (19)Flash Point: 174.141 °C; (20)Enthalpy of Vaporization: 61.05 kJ/mol; (21)Boiling Point: 364.33 °C at 760 mmHg; (22)Vapour Pressure: 0 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 174.1°C |
| Safety Data | |
 |
|
