Identification |
Name: | Benzene,1-bromo-4-chloro-2-methyl- |
Synonyms: | Toluene,2-bromo-5-chloro- (8CI);1-Bromo-2-methyl-4-chlorobenzene;1-Bromo-4-chloro-2-methylbenzene; |
CAS: | 14495-51-3 |
EINECS: | 238-503-4 |
Molecular Formula: | C7H6BrCl |
Molecular Weight: | 205.48 |
InChI: | InChI=1/C7H6BrCl/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
Molecular Structure: |
|
Properties |
Density: | 1.543 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.574-1.576 |
Water Solubility: | INSOLUBLE |
Solubility: | insoluble in water |
Appearance: | clear, colorless liquid. |
Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|