| Identification | |
| Name: | 1H-Inden-4-ol,7-chloro-2,3-dihydro- |
| Synonyms: | 4-Indanol,7-chloro- (6CI,7CI,8CI); 7-Chloro-4-indanol; Chlorindanol; Clorindanol;Lanesta; NSC 158565 |
| CAS: | 145-94-8 |
| Molecular Formula: | C9H9 Cl O |
| Molecular Weight: | 168.63 |
| InChI: | InChI=1/C9H9ClO/c10-8-4-5-9(11)7-3-1-2-6(7)8/h4-5,11H,1-3H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 91-93 DEG C |
| Flash Point: | 129.2°C |
| Boiling Point: | 290°Cat760mmHg |
| Density: | 1.308g/cm3 |
| Refractive index: | 1.618 |
| Specification: |
Chlorindanol , its cas register number is 145-94-8. It also can be called 1H-Inden-4-ol, 7-chloro-2,3-dihydro- ; 2,3-Dihydro-7-chloro-1H-inden-4-ol ; 4-06-00-03828 (Beilstein Handbook Reference) ; 4-Indanol, 7-chloro- ; 7-Chloro-2,3-dihydro-1H-inden-4-ol ; 7-Chloro-4-indanol ; BRN 1945696 ; Clorindanolum ; Lanesta ; NSC 158565 ; UNII-7902N03BH0 . It is moderately toxic by ingestion. When heated to decomposition it emits toxic fumes of Cl−. The storage environment of Chlorindanol (CAS NO.145-94-8) should be ventilate, low-temperature and dry. |
| Flash Point: | 129.2°C |
| Color: | NEEDLES FROM PETROLEUM ETHER |
| Safety Data | |
 |
|
