Identification |
Name: | Rizatriptan benzoate |
Synonyms: | 1H-Indole-3-ethanamine,N,N-dimethyl-5-(1H-1,2,4-triazol-1-ylmethyl)-, monobenzoate (9CI);MK 462;Maxalt;1H-Indole-3-ethanamine,N,N-dimethyl-5-(1H-1,2,4-triazol-1-ylmethyl)-, benzoate (1:1);Rizatriptan Benzoate Intermadiate; |
CAS: | 145202-66-0 |
Molecular Formula: | C15H19N5 |
Molecular Weight: | 391.4662 |
InChI: | InChI=1S/C15H19N5.C7H6O2/c1-19(2)6-5-13-8-17-15-4-3-12(7-14(13)15)9-20-11-16-10-18-20;8-7(9)6-4-2-1-3-5-6/h3-4,7-8,10-11,17H,5-6,9H2,1-2H3;1-5H,(H,8,9) |
Molecular Structure: |
 |
Properties |
Transport: | HAZARD |
Flash Point: | 259.1oC |
Boiling Point: | 504.8oCat760mmHg |
Density: | 1.21g/cm3 |
Refractive index: | 1.645 |
Water Solubility: | Soluble |
Solubility: | Soluble Appearance:white to off-white crystalline powder Transport Information:HAZARD Hazard Symbols:UN NO. |
Appearance: | white to off-white crystalline powder |
Flash Point: | 259.1oC |
Usage: | A selective serotonin 5-HTID receptor agonist. Structurally derived from tryptamine |
Safety Data |
Hazard Symbols |
|
|
 |