Name: | 1H,3H-Pyrrolo[1,2-c][1,3,2]oxazaborole,tetrahydro-1,3,3-triphenyl-, (3aR)- |
Synonyms: | 1H,3H-Pyrrolo[1,2-c][1,3,2]oxazaborole,tetrahydro-1,3,3-triphenyl-, (R)- |
Specification: |
The (R)-Tetrahydro-1,3,3-triphenyl-1H,3H-pyrrolo[1,2-c][1,3,2]oxazaborole, with the CAS number 145238-45-5, is also called H,3H-Pyrrolo[1,2-c][1,3,2]oxazaborole,tetrahydro-1,3,3-triphenyl-, (3aR)-. Its molecular formula is C23H22BNO. This chemical is a kind of organics. It should be stored in dry and cool environment.
The properties of the chemical are: (1)#H bond acceptors: 2; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 3; (4)Polar Surface Area: 12.47 Å2; (5)Index of Refraction: 1.64; (6)Molar Refractivity: 104.324 cm3; (7)Molar Volume: 289.419 cm3; (8)Polarizability: 41.357×10-24cm3; (9)Surface Tension: 49.504 dyne/cm; (10)Enthalpy of Vaporization: 71.796 kJ/mol; (11)Vapour Pressure: 0 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: C2CCN3B(OC(c1ccccc1)(C23)c4ccccc4)c5ccccc5
(2)InChI: InChI=1/C23H22BNO/c1-4-11-19(12-5-1)23(20-13-6-2-7-14-20)22-17-10-18-25(22)24(26-23)21-15-8-3-9-16-21/h1-9,11-16,22H,10,17-18H2
(3)InChIKey: GXAMQZFEKIDKAP-UHFFFAOYAC
|