| Identification | |
| Name: | 4-Butylphenylboronic acid |
| Synonyms: | Boronicacid, (4-butylphenyl)- (9CI);Boronic acid,B-(4-butylphenyl)-; |
| CAS: | 145240-28-4 |
| EINECS: | -0 |
| Molecular Formula: | C10BH15O2 |
| Molecular Weight: | 178.04 |
| InChI: | InChI=1/C10H15BO2/c1-2-3-4-9-5-7-10(8-6-9)11(12)13/h5-8,12-13H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143.4 ºC |
| Boiling Point: | 313.5 ºC at 760 mmHg |
| Density: | 1.03 g/cm3 |
| Refractive index: | 1.512 |
| Specification: |
4-Butylphenylboronic acid (CAS NO.145240-28-4) is also named as Boronic acid,B-(4-butylphenyl)- ; Boronicacid, (4-butylphenyl)- (9CI) ; 4-n-Butylbenzeneboronic acid . |
| Flash Point: | 143.4 ºC |
| Usage: |
4-Butylphenylboronic acid (CAS NO.145240-28-4) can be used as intermediates of liquid crystals. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
