| Identification | |
| Name: | Acetic acid, chloro-,ion(1-) (8CI,9CI) |
| Synonyms: | 2-Chloroacetate;Chloroacetate; Chloroacetate anion; Chloroacetate ion; Chloroacetate(1-);Chloroacetic acid ion(1-); Monochloroacetate; Monochloroacetate ion;Monochloroacetate ion(1-) |
| CAS: | 14526-03-5 |
| Molecular Formula: | C2H2 Cl O2 |
| Molecular Weight: | 93.490 |
| InChI: | InChI=1S/C2H3ClO2/c3-1-2(4)5/h1H2,(H,4,5)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 189.3 deg C |
| Solubility: | Soluble in ethanol, diethyl ether, benzene, chloroform; slightly soluble in carbon tetrachloride. ... good solubility in methanol, acetone, diethyl ether, and ethanol, but is only sparingly soluble in hydrocarbons and chlorinated hydrocarbons. In water, 8.58X10+5 mg/L at 25 deg C |
| Color: | Monoclinic prisms Colorless or white deliquescent crystals Colorless to light-brownish crystals ...colorless, hygroscopic, crystalline solid, which occurs in monoclinically prismatic structures... |
| Safety Data | |
 |
|
