| Identification | |
| Name: | 4-Thiazolecarboxylicacid, ethyl ester |
| Synonyms: | 4-Ethoxycarbonylthiazole;Ethyl 4-thiazolecarboxylate; |
| CAS: | 14527-43-6 |
| Molecular Formula: | C6H7NO2S |
| Molecular Weight: | 157.18 |
| InChI: | InChI=1/C6H7NO2S/c1-2-9-6(8)5-3-10-4-7-5/h3-4H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 42-44ºC |
| Density: | 1.242 g/cm3 |
| Refractive index: | 1.53 |
| Appearance: | Pale-yellow crystalline solid |
| Specification: |
Ethyl thiazole-4-carboxylate , with CAS number of 14527-43-6, can be called 4-thiazolecarboxylic acid, ethyl ester ; Ethyl 1,3-thiazole-4-carboxylate ; Ethyl thiazole-4-carboxylate ; Ethyl 1,3-thiazole-4-carboxylate 98% . It is a pale-yellow crystalline solid. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
