| Identification | |
| Name: | 1H-Inden-1-one,6-bromo-2,3-dihydro- |
| Synonyms: | 1-Indanone,6-bromo- (6CI,7CI,8CI);6-Bromo-1-indanone;6-Bromo-2,3-dihydro-1H-inden-1-one; |
| CAS: | 14548-39-1 |
| Molecular Formula: | C9H7BrO |
| Molecular Weight: | 211.05 |
| InChI: | InChI=1/C9H7BrO/c10-7-3-1-6-2-4-9(11)8(6)5-7/h1,3,5H,2,4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 111.6°C |
| Boiling Point: | 291.6°Cat760mmHg |
| Density: | 1.608g/cm3 |
| Refractive index: | 1.623 |
| Appearance: | White to yellow crystalline powder or needles |
| Specification: |
1H-Inden-1-one,6-bromo-2,3-dihydro- , with CAS number of 14548-39-1, can be called 6-Bromo-2,3-dihydroinden-1-one ; 6-bromo-1-indanone ; 6-bromo-indan-1-one ; 6-bromo indanone ; 6-Bromo-1-indanone,98% ; 6-Brom-2,3-dihydro-1H-inden-1-on .It is a white to yellow crystalline powder or needles. |
| Flash Point: | 111.6°C |
| Safety Data | |
 |
|
