| Identification | |
| Name: | Methanone,(4-methoxyphenyl)-4-pyridinyl- |
| Synonyms: | Ketone,p-methoxyphenyl 4-pyridyl (8CI) |
| CAS: | 14548-47-1 |
| Molecular Formula: | C13H11 N O2 |
| Molecular Weight: | 213.25 |
| InChI: | InChI=1/C13H11NO2/c1-16-12-4-2-10(3-5-12)13(15)11-6-8-14-9-7-11/h2-9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 176.5°C |
| Boiling Point: | 368.3°Cat760mmHg |
| Density: | 1.154g/cm3 |
| Refractive index: | 1.572 |
| Specification: |
p-Methoxyphenyl 4-pyridyl ketone , its cas register number is 14548-47-1. It also can be called 4-(4-Methoxybenzoyl)pyridine ; 5-21-12-00524 (Beilstein Handbook Reference) ; BRN 0392709 ; Ketone, p-anisyl 4-pyridyl ; Pyridine, 4-(4-methoxybenzoyl)- ; p-Anisyl 4-pyridyl ketone . And p-Methoxyphenyl 4-pyridyl ketone (CAS NO.14548-47-1) is a |
| Flash Point: | 176.5°C |
| Safety Data | |
 |
|
