| Identification | |
| Name: | 1-Propanone,1-[(4S)-4-(phenylmethyl)-2-thioxo-3-oxazolidinyl]- |
| Synonyms: | 2-Oxazolidinethione,3-(1-oxopropyl)-4-(phenylmethyl)-, (4S)- (9CI);2-Oxazolidinethione, 3-(1-oxopropyl)-4-(phenylmethyl)-,(S)-; |
| CAS: | 145588-95-0 |
| Molecular Formula: | C13H15NO2S |
| Molecular Weight: | 249.33 |
| InChI: | InChI=1/C13H15NO2S/c1-2-12(15)14-11(9-16-13(14)17)8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3/t11-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 74-75 ºC |
| Density: | 1.234 g/cm3 |
| Refractive index: | 1.609 |
| Specification: |
The (S)-4-Benzyl-3-propionyl-1,3-oxazolidine-2-thione ,its cas register number is 145588-95-0.It also can be called as 1-Propanone,1-[(4S)-4-(phenylmethyl)-2-thioxo-3-oxazolidinyl]- and the Systematic name about this chemicals is (4S)-4-benzyl-3-propanoyl-1,3-oxazolidine-2-thione . Following are the chemical properties about (S)-4-Benzyl-3-propionyl-1,3-oxazolidine-2-thione :(1)#H bond acceptors: 3 ; (2)#H bond donors: 0 ; (3)#Freely Rotating Bonds: 3 ; (4)Polar Surface Area: 61.63Å2 ; (5)Index of Refraction: 1.609 ; (6)Molar Refractivity: 69.952 cm3 ; (7)Molar Volume: 201.976 cm3 ; (8)Surface Tension: 55.408 dyne/cm ; (9)Enthalpy of Vaporization: 59.08 kJ/mol This chemicals can be described computed from structure: |
| Safety Data | |
 |
|
