| Identification | |
| Name: | Morpholine,2,6-dimethyl-4-nitroso- |
| Synonyms: | 2,6-Dimethyl-N-nitrosomorpholine;2,6-Dimethylnitrosomorpholine; N-Nitroso-2,6-dimethylmorpholine; NSC 69924 |
| CAS: | 1456-28-6 |
| Molecular Formula: | C6H12 N2 O2 |
| Molecular Weight: | 144.20 |
| InChI: | InChI=1/C6H12N2O2/c1-5-3-8(7-9)4-6(2)10-5/h5-6H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 93.9°C |
| Boiling Point: | 231.7°C at 760 mmHg |
| Density: | 1.22g/cm3 |
| Refractive index: | 1.531 |
| Specification: |
N-Nitroso-2,6-dimethylmorpholine ,its cas register number is 1456-28-6. It also can be called Morpholine, 2,6-dimethyl-4-nitroso-, (E)- ; Morpholine, 2,6-dimethyl-4-nitroso-, (Z)- ; and Morpholine, 2,6-dimethyl-4-nitroso- . |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 93.9°C |
| Safety Data | |
 |
|
