| Identification | |
| Name: | 2-Chloroadenosine |
| Synonyms: | Cl-Ado;6-Amino-2-chloropurine riboside;(2R,3R,4R,5R)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;4-26-00-03725 (Beilstein Handbook Reference);2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;Antibiotic AT 265B;Adenosine,2-chloro-;2-Chloroadenosinehemihydrate; |
| CAS: | 146-77-0 |
| EINECS: | 205-678-3 |
| Molecular Formula: | C10H12ClN5O4 |
| Molecular Weight: | 301.69 |
| InChI: | InChI=1/C10H12ClN5O4/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15)/t3-,5-,6-,9-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 2.19 g/cm3 |
| Water Solubility: | soluble in methanol |
| Solubility: | soluble in methanol |
| Appearance: | white powder |
| Biological Activity: | Metabolically stable analog of adenosine that behaves as an adenosine receptor agonist (K i values are 300, 80 and 1900 nM for A 1 , A 2A and A 3 receptors respectively). Anticonvulsive in vivo . |
| Usage: | A selective A1-adenosine receptor agonist. Induces apoptosis |
| Safety Data | |
| Hazard Symbols | |
 |
|
