| Identification | |
| Name: | 8-Quinolinol,5,6,7,8-tetrahydro- |
| Synonyms: | 5,6,7,8-Tetrahydro-8-quinolinol;8-Hydroxy-5,6,7,8-tetrahydroquinoline; |
| CAS: | 14631-46-0 |
| Molecular Formula: | C9H11NO |
| Molecular Weight: | 149.19 |
| InChI: | InChI=1/C9H11NO/c11-8-5-1-3-7-4-2-6-10-9(7)8/h2,4,6,8,11H,1,3,5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.179 g/cm3 |
| Refractive index: | 1.59 |
| Specification: |
The 5,6,7,8-Tetrahydroquinolin-8-ol, with cas registry number 14631-46-0, belongs to the following product categories: Quinoline Derivertives. It has the systematic name of 5,6,7,8-tetrahydroquinolin-8-ol. Besides this, it is also called 8-Quinolinol, 5,6,7,8-tetrahydro-. Physical properties about this chemical are: (1)ACD/LogP: 0.56; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 22.12 Å2; (7)Index of Refraction: 1.59; (8)Molar Refractivity: 42.72 cm3; (9)Molar Volume: 126.4 cm3; (10)Polarizability: 16.93×10-24cm3; (11)Surface Tension: 48.8 dyne/cm; (12)Enthalpy of Vaporization: 58.1 kJ/mol; (13)Vapour Pressure: 0.000274 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
