| Identification | |
| Name: | 1H-Indole-3-acetonitrile,4-(phenylmethoxy)- |
| Synonyms: | Indole-3-acetonitrile,4-(benzyloxy)- (7CI,8CI); 4-Benzyloxyindole-3-acetonitrile |
| CAS: | 1464-11-5 |
| Molecular Formula: | C17H14N2O |
| Molecular Weight: | 262.31 |
| InChI: | InChI=1/C17H14N2O/c18-10-9-14-11-19-15-7-4-8-16(17(14)15)20-12-13-5-2-1-3-6-13/h1-8,11,19H,9,12H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.233g/cm3 |
| Refractive index: | 1.667 |
| Appearance: | Light brown solid |
| Specification: |
4-Benzyloxyindole-3-acetonitrile , its cas register number is 1464-11-5. It also can be called |
| Usage: | A tryptamine derivative, also an intermediate in the synthesis of the neurotransmitter agonist 4-Hydroxytryptamine Creatinine |
| Safety Data | |
 |
|
