| Identification | |
| Name: | 1,2-Propanediamine,N1,N1-diethyl- |
| Synonyms: | 1-Diethylamino-2-aminopropane;2-(Diethylamino)-1-methylethylamine; 2-Amino-1-(diethylamino)propane;N,N-Diethyl-1,2-propanediamine |
| CAS: | 14642-66-1 |
| Molecular Formula: | C7H18 N2 |
| Molecular Weight: | 130.23 |
| InChI: | InChI=1/C7H18N2/c1-4-9(5-2)6-7(3)8/h7H,4-6,8H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 44.2°C |
| Boiling Point: | 154.5°Cat760mmHg |
| Density: | 0.838g/cm3 |
| Refractive index: | 1.449 |
| Specification: |
N-(2-Aminopropyl)-N,N-diethylamine , its cas register number is 14642-66-1. It also can be called N~1~,N~1~-Diethylpropane-1,2-diamine ; and 1,2-Propanediamine, N~1~,N~1~-diethyl- . |
| Flash Point: | 44.2°C |
| Safety Data | |
 |
|
