| Identification | |
| Name: | Ethyl 5-bromovalerate |
| Synonyms: | Valericacid, 5-bromo-, ethyl ester (6CI,7CI,8CI);5-Bromopentanoate ethyl ester;5-Bromopentanoic acid ethyl ester;5-Bromovaleric acid ethyl ester;Ethyl5-bromopentanoate;Ethyl d-bromovalerate; |
| CAS: | 14660-52-7 |
| EINECS: | 238-705-2 |
| Molecular Formula: | C7H13BrO2 |
| Molecular Weight: | 209.08 |
| InChI: | InChI=1/C7H13BrO2/c1-2-10-7(9)5-3-4-6-8/h2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.321 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.457-1.46 |
| Solubility: | Insoluble |
| Appearance: | Clear colorless to pale yellow liquid |
| Specification: |
Ethyl 5-bromovalerate (CAS NO.14660-52-7), its Synonyms are Pentanoic acid, 5-bromo-, ethyl ester ; 5-Bromopentanoate ethyl ester ; Valeric acid, 5-bromo-, ethyl ester . It is clear colorless to pale yellow liquid. |
| Storage Temperature: | Store at RT. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
