Identification |
Name: | 4H-1-Benzopyran-4-one,7-ethoxy-3-(4-hydroxyphenyl)- |
Synonyms: | 4H-1-benzopyran-4-one, 7-ethoxy-3-(4-hydroxyphenyl)-;7-ethoxy-3-(4-hydroxyphenyl)-4H-chromen-4-one |
CAS: | 146698-96-6 |
Molecular Formula: | C17H14 O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C17H14O4/c1-2-20-13-7-8-14-16(9-13)21-10-15(17(14)19)11-3-5-12(18)6-4-11/h3-10,18H,2H2,1H3 |
Molecular Structure: |
![(C17H14O4) 4H-1-benzopyran-4-one, 7-ethoxy-3-(4-hydroxyphenyl)-;7-ethoxy-3-(4-hydroxyphenyl)-4H-chromen-4-one](https://img1.guidechem.com/chem/e/dict/3/146698-96-6.jpg) |
Properties |
Flash Point: | 182.1°C |
Boiling Point: | 484.8°C at 760 mmHg |
Density: | 1.293g/cm3 |
Refractive index: | 1.627 |
Flash Point: | 182.1°C |
Usage: | A potent inhibitor of MOA and aldehyde dehydrogenase isozyme (ALDH2) |
Safety Data |
|
![](/images/detail_15.png) |