| Identification | |
| Name: | Hydrazinecarboxylicacid, 2-(1-phthalazinyl)-, ethyl ester |
| Synonyms: | Carbazicacid, 3-(1-phthalazinyl)-, ethyl ester (8CI); Carboethoxyphthalazinohydrazine;N1-Carbethoxy-N2-phthalazinehydrazine; Todralazine |
| CAS: | 14679-73-3 |
| Molecular Formula: | C11H12 N4 O2 |
| Molecular Weight: | 232.27 |
| InChI: | InChI=1/C11H12N4O2.ClH/c1-2-17-11(16)15-14-10-9-6-4-3-5-8(9)7-12-13-10;/h3-7H,2H2,1H3,(H,13,14)(H,15,16);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.328g/cm3 |
| Specification: |
N-Carboethoxy-N'-phthalazino-hydrazine (CAS NO.14679-73-3) is also named as 3-(1-Phthalazinyl)carbazic acid ethyl ester ; 5-25-17-00414 (Beilstein Handbook Reference) ; BRN 0233300 ; BT 621 ; Carboethoxyphthalazinohydrazine ; Ethyl 3-(1-phthalazinyl)carbazate ; Todralacina ; Todralacina [Spanish] ; Todralazina ; Todralazina [INN-Spanish] ; Todralazine ; Todralazinum ; Todralazinum [INN-Latin] ; UNII-WEN3K83YKD ; Carbazic acid, 3-(1-phthalazinyl)-, ethyl ester ; Hydrazinecarboxylic acid, 2-(1-phthalazinyl)-, ethyl ester (9CI) . N-Carboethoxy-N'-phthalazino-hydrazine (CAS NO.14679-73-3) is highly toxic. It will produce toxic nitrogen oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. Keep N-Carboethoxy-N'-phthalazino-hydrazine (CAS NO.14679-73-3) separate from raw materials of food. |
| Flash Point: | °C |
| Safety Data | |
 |
|
