| Identification | |
| Name: | 1H-Indene-1,3(2H)-dione,5-bromo-2-phenyl- |
| Synonyms: | 1,3-Indandione,5-bromo-2-phenyl- (6CI,7CI,8CI); 5-Bromo-2-phenyl-1,3-indandione;Isobromindione; Uridion |
| CAS: | 1470-35-5 |
| EINECS: | 216-000-0 |
| Molecular Formula: | C15H9 Br O2 |
| Molecular Weight: | 301.15 |
| InChI: | InChI=1/C15H9BrO2/c16-10-6-7-11-12(8-10)15(18)13(14(11)17)9-4-2-1-3-5-9/h1-8,13H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 161.8°C |
| Boiling Point: | 468.5°Cat760mmHg |
| Density: | 1.569g/cm3 |
| Refractive index: | 1.659 |
| Specification: |
Isobromindione ,its cas register number is 1470-35-5. It also can be called 5-Bromo-2-phenyl-1H-indene-1,3(2H)-dione ; and Uridion . |
| Flash Point: | 161.8°C |
| Safety Data | |
 |
|
