| Identification |
| Name: | 1,3-Oxathiolane-2-carboxylicacid, 5-(acetyloxy)-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester,(2R,5R)- |
| Synonyms: | 1,3-Oxathiolane-2-carboxylicacid, 5-(acetyloxy)-, 5-methyl-2-(1-methylethyl)cyclohexyl ester, [1R-[1a(2R*,5R*),2b,5a]]- |
| CAS: | 147027-09-6 |
| Molecular Formula: | C16H26 O5 S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C16H26O5S/c1-9(2)12-6-5-10(3)7-13(12)20-15(18)16-21-14(8-22-16)19-11(4)17/h9-10,12-14,16H,5-8H2,1-4H3/t10-,12+,13-,14-,16-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 190.406°C |
| Boiling Point: | 412.459°C at 760 mmHg |
| Density: | 1.16g/cm3 |
| Refractive index: | 1.511 |
| Flash Point: | 190.406°C |
| Usage: | An intermediate for the preparation of Lamivudine and Emtricitabine. |
| Safety Data |
| |
 |
