Identification |
Name: | 3-Phenylbenzyl bromide |
Synonyms: | Biphenyl,3-(bromomethyl)- (8CI);3-(Bromomethyl)biphenyl;3-Bromomethyl-1,1'-biphenyl;1,1'-Biphenyl,3-(bromomethyl)-;m-Phenylbenzyl bromide;3-Bromo methylphenylbenzene; |
CAS: | 14704-31-5 |
Molecular Formula: | C13H11Br |
Molecular Weight: | 247.13 |
InChI: | InChI=1/C13H11Br/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-9H,10H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3261 |
Melting Point: | 57-61 ºC |
Flash Point: | 158.1°C |
Density: | 1.341g/cm3 |
Refractive index: | 1.605 |
Appearance: | off-white to light yellow crystal powder |
Flash Point: | 158.1°C |
Safety Data |
Hazard Symbols |
C: Corrosive
N: Dangerous for the environment
|
|
 |