Butanamide,N,N'-1,2-ethanediylbis[3-oxo- (1471-94-9)

The N,N'-Ethylenebisacetoacetamide with the cas number 1471-94-9 is also called Butanamide,N,N'-1,2-ethanediylbis[3-oxo-. The IUPAC name is 3-oxo-N-[2-(3-oxobutanoylamino)ethyl]butanamide. Its EINECS registry number is 216-011-0. The molecular formula is C₁₀H₁₆N₂O₄. This chemical belongs to the following product categories: (1)Amides; (2)Carbonyl Compounds; (3)Organic Building Blocks.

The properties of the chemical are: (1)ACD/LogP: -2.48; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -2.48; (4)ACD/LogD (pH 7.4): -2.48; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1.07; (8)ACD/KOC (pH 7.4): 1.06; (9)#H bond acceptors: 6; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 7; (12)Polar Surface Area: 74.76 Å²; (13)Index of Refraction: 1.469; (14)Molar Refractivity: 55.68 cm³; (15)Molar Volume: 199.7 cm³; (16)Polarizability: 22.07×10^-24cm³; (17)Surface Tension: 41.2 dyne/cm; (18)Enthalpy of Vaporization: 81.67 kJ/mol; (19)Vapour Pressure: 1.06×10^-11 mmHg at 25°C.

Preparation: This chemical can be prepared by the reaction of diketene and ethane-1,2-diamine. The reaction time is 2.0 hours. The yield is 92%.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(NCCNC(=O)CC(=O)C)CC(=O)C
(2)InChI: InChI=1/C10H16N2O4/c1-7(13)5-9(15)11-3-4-12-10(16)6-8(2)14/h3-6H2,1-2H3,(H,11,15)(H,12,16)
(3)InChIKey: KLZDEEDOBAPARF-UHFFFAOYAB