| Identification | |
| Name: | Indole-2-carboxylic acid |
| Synonyms: | 1H-Indole-2-carboxylic acid (9CI);1H-indole-2-carboxylate;2-Carboxyindole;2-Indole carboxylic acid,methyl ester;2-Indolecarboxylic acid:Indole-2-carboxylic acid;indole-2-formic acid;Indole-2-carboxlicacid;1H-2-Indolecarboxylic acid; |
| CAS: | 1477-50-5 |
| EINECS: | 216-030-4 |
| Molecular Formula: | C9H7NO2 |
| Molecular Weight: | 161.16 |
| InChI: | InChI=1/C9H7NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-5,10H,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.408 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. Light sensitive. |
| Solubility: | Very soluble |
| Appearance: | Off-White crystal powder |
| Specification: |
?Indole-2-carboxylic acid , its CAS NO. is 1477-50-5, the synonyms are 2-Carboxyindole ; 2-Indolecarboxylic acid ; 1H-Indole-2-carboxylic acid (9CI) . |
| HS Code: | 29339990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
Xn: Harmful
|
 |
|
