| Identification | |
| Name: | 2-Pyrrolidinone,1-methyl-5-(2-pyridinyl)- |
| CAS: | 147732-31-8 |
| Molecular Formula: | C10H12 N2 O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H12N2O/c1-12-9(5-6-10(12)13)8-4-2-3-7-11-8/h2-4,7,9H,5-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 167.9°C |
| Boiling Point: | 354.1°C at 760 mmHg |
| Density: | 1.146g/cm3 |
| Refractive index: | 1.555 |
| Flash Point: | 167.9°C |
| Usage: | A metabolite of nicotine in humans. Used for internal standardization for routine biomonitoring of nicotine metabolites |
| Safety Data | |
 |
|
