| Identification | |
| Name: | 2-Benzothiazolamine,5-methyl- |
| Synonyms: | Benzothiazole,2-amino-5-methyl- (6CI,8CI);5-Methyl-2-Benzothiazolylamine;5-Methyl-2-aminobenzothiazole;NSC 44453;NSC45346; |
| CAS: | 14779-17-0 |
| Molecular Formula: | C8H8N2S |
| Molecular Weight: | 164.23 |
| InChI: | InChI=1/C8H8N2S/c1-5-2-3-7-6(4-5)10-8(9)11-7/h2-4H,1H3,(H2,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148.6°C |
| Boiling Point: | 322°Cat760mmHg |
| Density: | 1.315g/cm3 |
| Refractive index: | 1.726 |
| Specification: |
2-Benzothiazolamine,5-methyl- with cas registry number of 14779-17-0 is also known as 2-Amino-5-methylbenzothiazole ; 5-Methyl-2-aminobenzothiazole ; 2-Benzothiazolamine, 5-methyl- (9CI) ; Benzothiazole, 2-amino-5-methyl- . 2-Benzothiazolamine,5-methyl- with cas registry number of 14779-17-0 is used as a pharmaceutical intermediate. |
| Flash Point: | 148.6°C |
| Safety Data | |
 |
|
