| Identification | |
| Name: | 3-Methoxysalicylaldehyde |
| Synonyms: | m-Anisaldehyde,2-hydroxy- (8CI);o-Vanillin (6CI);2-Hydroxy-3-methoxybenzaldehyde;2-Hydroxy-m-anisaldehyde;2-Vanillin;3-Methoxy-2-hydroxybenzaldehyde;6-Formyl-2-methoxyphenol;6-Formylguaiacol;NC 005;NSC 2150;Benzaldehyde,2-hydroxy-3-methoxy-; |
| CAS: | 148-53-8 |
| EINECS: | 205-715-3 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C8H8O3/c1-11-7-4-2-3-6(5-9)8(7)10/h2-5,10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.231 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5632 (45 C) |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | fibrous, light-yellow, crystalline solid |
| Specification: |
o-Vanillin (CAS NO.148-53-8) is also named as 2-Hydroxy-m-anisaldehyde ; 3-Methoxy-2-hydroxybenzaldehyde ; 3-Methoxysalicylaldehyde ; 4-08-00-01747 (Beilstein Handbook Reference) ; 6-Formyl-2-methoxyphenol ; 6-Formylguaiacol ; AI3-00076 ; BRN 0471913 ; CCRIS 8811 ; NSC 2150 ; O-Vanillin ; Orthovanilline ; Oxy-2 methoxy-3 benzaldehyde ; Oxy-2 methoxy-3 benzaldehyde [French] ; o-Vanilline . o-Vanillin (CAS NO.148-53-8) is a fibrous, light-yellow, crystalline solid. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29124900 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Sensitive: | Air Sensitive |
| Usage: | Used in the study of mutagenesis and as a synthetic precursor for pharmaceuticals. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
