| Identification | |
| Name: | 1,2-Ethanediamine,N1-[(5-chloro-2-thienyl)methyl]-N2,N2-dimethyl-N1-2-pyridinyl- |
| Synonyms: | polyvinylbutyral resin;poly(vinyl butyral);poly(vinyl butyral) 1,000;poly(vinyl butyral) 2,000;poly(vinyl butyral) 2,400;poly(vinyl butyral) 630;poly(vinyl butyral) 800;poly(vinyl butyral) 920 |
| CAS: | 148-65-2 |
| Molecular Formula: | C14H18 Cl N3 S |
| Molecular Weight: | 295.86 |
| InChI: | InChI=1/C14H18ClN3S/c1-17(2)9-10-18(14-5-3-4-8-16-14)11-12-6-7-13(15)19-12/h3-8H,9-11H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 201°C |
| Boiling Point: | 408.8°Cat760mmHg |
| Density: | 1.234g/cm3 |
| Refractive index: | 1.619 |
| Specification: |
Chloromethapyrilene , its cas register number is 148-65-2. It also can be called 1,2-Ethanediamine,N-((5-chloro-2-thienyl)methyl)-N',N'-dimethyl-N-2-pyridinyl- ; Chlorothen and Pyridine, 2-((5-chloro-2-thenyl)(2-(dimethylamino)ethyl)amino)- .When Chloromethapyrilene (CAS NO.148-65-2) is heated to decomposition, it emits very toxic fumes of Cl−, NOx, and SOx. |
| Flash Point: | 201°C |
| Color: | Liquid |
| Safety Data | |
 |
|
