| Identification | |
| Name: | Propanenitrile,3-(ethylphenylamino)- |
| Synonyms: | Propionitrile,3-(N-ethylanilino)- (6CI,7CI,8CI);3-(Ethylphenylamino)propionitrile;3-(N-Ethylanilino)propionitrile;N-(2-Cyanoethyl)-N-ethylaniline;N-Ethyl-N-(2-cyanoethyl)aniline;N-Ethyl-N-(b-cyanoethyl)aniline;N-b-Cyanoethyl-N-ethylaminobenzene;N-b-Cyanoethyl-N-ethylaniline;NSC81243; |
| CAS: | 148-87-8 |
| EINECS: | 205-728-4 |
| Molecular Formula: | C11H14N2 |
| Molecular Weight: | 174.24 |
| InChI: | InChI=1/C11H14N2/c1-2-13(10-6-9-12)11-7-4-3-5-8-11/h3-5,7-8H,2,6,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.03 |
| Refractive index: | 1.551 |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | yellow to brown liquid |
| Report: |
Reported in EPA TSCA Inventory. Cyanide and its compounds are on the Community Right-To-Know List. |
| Safety Data | |
| Hazard Symbols | |
 |
|
