| Identification |
| Name: | Phenol,4-(hexyloxy)-2,3,6-trimethyl- |
| Synonyms: | 1-O-Hexyl-2,3,5-trimethylhydroquinone;4-Hexyloxy-2,3,6-trimethylphenol; HTHQ |
| CAS: | 148081-72-5 |
| Molecular Formula: | C15H24 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H24O2/c1-5-6-7-8-9-17-14-10-11(2)15(16)13(4)12(14)3/h10,16H,5-9H2,1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 154.4°C |
| Boiling Point: | 357.8°Cat760mmHg |
| Density: | 0.971g/cm3 |
| Refractive index: | 1.507 |
| Flash Point: | 154.4°C |
| Usage: | A novel phenolic antioxidant that showed strong antimutagenic activity against eight carcinogenic heterocyclic amines (HCA), produced during cooking processes. Its antimutagenic activity appeared to inhibit both metabolic activation of HCA and acti |
| Safety Data |
| |
 |
