| Identification |
| Name: | 3,4-Methylenedioxy-b-nitrostyrene |
| Synonyms: | 3,4-Methylenedioxy-beta-nitrostyrene; 1-(3,4-Methylenedioxy)phenyl-2-nitroethene |
| CAS: | 1485-00-3 |
| Molecular Formula: | C9H7NO4 |
| Molecular Weight: | 193.16 |
| InChI: | InChI=1/C9H7NO4/c11-10(12)4-3-7-1-2-8-9(5-7)14-6-13-8/h1-5H,6H2/b4-3+ |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 6.1/PG 3 |
| Density: | 1.401 g/cm3 |
| Refractive index: | 1.64 |
| Appearance: | yellow powder |
| Biological Activity: | Selective inhibitor of Src and Syk tyrosine kinases. Displays antiaggregative activity via inhibition of GPIIb/IIIa activation (IC 50 = 12.7 μ M for thrombin-induced platelet aggregation). Exhibits no effects on Ca 2+ -dependent enzymes, PKC or arachidonic acid metabolism. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
