| Identification | |
| Name: | 2-Naphthaleneethanol |
| Synonyms: | 2-(2-Hydroxyethyl)naphthalene;2-(2-Naphthyl)ethanol;2-(2-Naphthyl)ethyl alcohol;2-Naphthalen-2-ylethanol;2-b-Naphthylethanol;NSC 21040; |
| CAS: | 1485-07-0 |
| EINECS: | 216-061-3 |
| Molecular Formula: | C12H12O |
| Molecular Weight: | 172.22 |
| InChI: | InChI=1/C12H12O/c13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-6,9,13H,7-8H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.119 g/cm3 |
| Refractive index: | 1.636 |
| Specification: |
The Naphthalen-2-ethanol is an organic compound with the formula C12H12O. The IUPAC name of this chemical is 2-naphthalen-2-ylethanol. With the CAS registry number 1485-07-0, it is also named as 1-Naphthaleneethanol. The product's categories are Naphthalene Derivatives; Electronic Chemicals; Miscellaneous; Alcohols; C9 to C30; Oxygen Compounds. Besides, it should be stored in a closed, cool, dry place at room temperature. Physical properties about Naphthalen-2-ethanol are: (1)ACD/LogP: 2.59; (2)ACD/LogD (pH 5.5): 2.59; (3)ACD/LogD (pH 7.4): 2.59; (4)ACD/BCF (pH 5.5): 54.73; (5)ACD/BCF (pH 7.4): 54.73; (6)ACD/KOC (pH 5.5): 610.67; (7)ACD/KOC (pH 7.4): 610.67; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 3; (11)Polar Surface Area: 9.23 Å2; (12)Index of Refraction: 1.636; (13)Molar Refractivity: 55.17 cm3; (14)Molar Volume: 153.8 cm3; (15)Polarizability: 21.87×10-24cm3; (16)Surface Tension: 47.7 dyne/cm; (17)Density: 1.119 g/cm3; (18)Flash Point: 150.6 °C; (19)Enthalpy of Vaporization: 58.27 kJ/mol; (20)Boiling Point: 311 °C at 760 mmHg; (21)Vapour Pressure: 0.000248 mmHg at 25°C. Preparation: this chemical can be prepared by naphthalen-2-yl-acetic acid. This reaction will need reagent LiAlH4 and solvent diethyl ether.
You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
