| Identification | |
| Name: | 1,3-Dibromo-5-chlorobenzene |
| Synonyms: | 3,5-Dibromochlorobenzene;1-Chloro-3,5-dibromobenzene; |
| CAS: | 14862-52-3 |
| Molecular Formula: | C6H3Br2Cl |
| Molecular Weight: | 270.35 |
| InChI: | InChI=1/C6H3Br2Cl/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.021 g/cm3 |
| Refractive index: | 1.612 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
1,3-Dibromo-5-chlorobenzene , with CAS number of 14862-52-3, can be called benzene, 1,3-dibromo-5-chloro- ; 3,5-Dibromo Chlorobenzene ; 3,5-Dibromochlorobenzene . It is a white to light yellow crystal powder. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
