| Identification | |
| Name: | Benzene,1,2,3-trifluoro- |
| Synonyms: | 2,3,4-Trifluorobenzene; |
| CAS: | 1489-53-8 |
| Molecular Formula: | C6H3F3 |
| Molecular Weight: | 132.08 |
| InChI: | InChI=1/C6H3F3/c7-4-2-1-3-5(8)6(4)9/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.28 |
| Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.422-1.424 |
| Appearance: | clear colorless to slightly yellow liquid |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
