| Identification | |
| Name: | 2-Ethylhexanoic acid |
| Synonyms: | 2-Ethylcapronic acid; 2-ethylcaproic acid; 3% 2-Ethylhexanoic Acid |
| CAS: | 149-57-5 |
| EINECS: | 205-743-6 |
| Molecular Formula: | C8H16O2 |
| Molecular Weight: | 144.21 |
| InChI: | InChI=1/C8H16O2/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 180kgs |
| Density: | 0.906 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, reducing agents, bases. |
| Refractive index: | 1.424-1.426 |
| Solubility: | slightly soluble AUTOIGNITION |
| Appearance: | clear liquid |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Clear liquid |
| Usage: | Cosolvent and defoamer in pesticides. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
