2-Pyridinepropanoicacid, b-amino- (149251-81-0)

The 3-Amino-3-(pyridin-2-yl)propanoic acid, with the CAS registry number 149251-81-0, is also known as 2-Pyridinepropanoic acid, β-amino-. It belongs to the product categories of Pharmacetical; API intermediates. This chemical's molecular formula is C₈H₁₀N₂O₂ and molecular weight is 166.18. Its systematic name is called 3-amino-3-(pyridin-2-yl)propanoic acid.

Physical properties of 3-Amino-3-(pyridin-2-yl)propanoic acid: (1)ACD/LogP: -1.51; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 4; (7)#H bond donors: 3; (8)#Freely Rotating Bonds: 4; (9)Index of Refraction: 1.58; (10)Molar Refractivity: 43.629 cm³; (11)Molar Volume: 131.033 cm³ ; (12)Surface Tension: 61.736 dyne/cm; (13)Density: 1.268 g/cm³; (14)Flash Point: 149.463 °C; (15)Enthalpy of Vaporization: 59.695 kJ/mol; (16)Boiling Point: 323.526 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: NC(CC(O)=O)c1ccccn1
(2)InChI: InChI=1/C8H10N2O2/c9-6(5-8(11)12)7-3-1-2-4-10-7/h1-4,6H,5,9H2,(H,11,12)
(3)InChIKey: WCLGSNNEAOFFCL-UHFFFAOYAD