| Identification | |
| Name: | 2-Pyridinecarboxylicacid, 4-nitro-, 1-oxide |
| Synonyms: | Picolinicacid, 4-nitro-, 1-oxide (6CI,7CI,8CI);2-Carboxy-4-nitropyridine N-oxide;2-Carboxylic acid-4-nitropyridine-1-oxide;4-Nitro-2-pyridinecarboxylic acid1-oxide;4-Nitropicolinic acid N-oxide;NSC 63059; |
| CAS: | 14933-78-9 |
| EINECS: | 239-008-6 |
| Molecular Formula: | C6H4N2O5 |
| Molecular Weight: | 184.11 |
| InChI: | InChI=1/C6H4N2O5/c9-6(10)5-3-4(8(12)13)1-2-7(5)11/h1-3,5H/p+1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.69g/cm3 |
| Specification: |
The 4-Nitropyridine-2-carboxylic acid 1-oxide with cas registry number of 14933-78-9, belongs to the following product categorie: Pyridines. It has the systematic name of 4-nitropyridine-2-carboxylic acid 1-oxide. And its IUPAC name is 4-nitro-1-oxidopyridin-1-ium-2-carboxylic acid. Physical properties about this chemical are: (1)ACD/LogP: -0.68; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -3.81; (4)ACD/LogD (pH 7.4): -3.83; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 7; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 96.23 Å2; (13)Index of Refraction: 1.653; (14)Molar Refractivity: 39.81 cm3; (15)Molar Volume: 108.6 cm3; (16)Polarizability: 15.78×10-24cm3; (17)Surface Tension: 82.8 dyne/cm; (18)Enthalpy of Vaporization: 87.8 kJ/mol; (19)Vapour Pressure: 4.34E-13 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
