| Identification | |
| Name: | 6-Azaspiro[3.4]octane-5,7-dione |
| Synonyms: | 6-azaspiro[3.4]octane-5,7-dione |
| CAS: | 1497-16-1 |
| EINECS: | 216-090-1 |
| Molecular Formula: | C7H9 N O2 |
| Molecular Weight: | 139.17 |
| InChI: | InChI=1/C7H9NO2/c9-5-4-7(2-1-3-7)6(10)8-5/h1-4H2,(H,8,9,10) |
| Molecular Structure: | ![(C7H9NO2) 6-azaspiro[3.4]octane-5,7-dione](https://img1.guidechem.com/chem/e/dict/21/1497-16-1.jpg) |
| Properties | |
| Flash Point: | 168.6°C |
| Boiling Point: | 333.6°C at 760 mmHg |
| Density: | 1.27g/cm3 |
| Refractive index: | 1.538 |
| Specification: |
6-Azaspiro(3.4)octane-5,7-dione , its cas register number is 1497-16-1. It also can be called 5-21-10-00068 (Beilstein Handbook Reference) ; Aza-6-spiro(3,4)octane-dione-5,7 ; BRN 1525974 ; EINECS 216-090-1 ; LD 4070 . And 6-Azaspiro(3.4)octane-5,7-dione (CAS NO.1497-16-1) is moderate toxic by ingestion and intraperitoneal routes. When heated to decomposition it emits toxic fumes of NOx. The storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 168.6°C |
| Safety Data | |
 |
|
