Identification |
Name: | 1-Isoquinolineacetamide,3,4-dihydro-6,7-dimethoxy-a-phenyl-N,N-bis[2-(2,3,4-trimethoxyphenyl)ethyl]- |
CAS: | 149759-26-2 |
Molecular Formula: | C41H48 N2 O9 |
Molecular Weight: | 0 |
InChI: | InChI=1/C41H48N2O9/c1-45-31-16-14-27(37(49-5)39(31)51-7)19-22-43(23-20-28-15-17-32(46-2)40(52-8)38(28)50-6)41(44)35(26-12-10-9-11-13-26)36-30-25-34(48-4)33(47-3)24-29(30)18-21-42-36/h9-17,24-25,35H,18-23H2,1-8H3 |
Molecular Structure: |
![(C41H48N2O9) 1-Isoquinolineacetamide,3,4-dihydro-6,7-dimethoxy-a-phenyl-N,N-bis[2-(2,3,4-trimethoxyphenyl)ethyl]-...](https://img1.guidechem.com/chem/e/dict/23/149759-26-2.jpg) |
Properties |
Flash Point: | 439.9°C |
Boiling Point: | 803.7°Cat760mmHg |
Density: | 1.17g/cm3 |
Refractive index: | 1.561 |
Biological Activity: | Broad spectrum cation channel blocker. Inhibits several cation channels including store-operated calcium channels (SOCs), voltage-operated calcium channels (VOCs), non-selective cation channels (NSCCs), AMPA, NMDA, Na + and K + channels. Neuroprotective; reduces cortical infarct size and improves neurological outcome following middle cerebral artery occlusion. |
Flash Point: | 439.9°C |
Safety Data |
|
![](/images/detail_15.png) |