Identification |
Name: | 2,4(1H,3H)-Pyrimidinedione,1-(ethoxymethyl)-5-(1-methylethyl)-6-(phenylmethyl)- |
Synonyms: | 1-(Ethoxymethyl)-6-benzyl-5-isopropyluracil;Coactinon; Emivirine; I-EBU; MKC 442 |
CAS: | 149950-60-7 |
Molecular Formula: | C17H22 N2 O3 |
Molecular Weight: | 302.41 |
InChI: | InChI=1/C17H22N2O3/c1-4-22-11-19-14(10-13-8-6-5-7-9-13)15(12(2)3)16(20)18-17(19)21/h5-9,12H,4,10-11H2,1-3H3,(H,18,20,21) |
Molecular Structure: |
|
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | 1.133g/cm3 |
Refractive index: | 1.542 |
Specification: |
Emivirine ,its cas register number is 149950-60-7. It also can be called MKC 442 ; and 6-Benzyl-1-(ethoxymethyl)-5-isopropylpyrimidine-2,4(1H,3H)-dione . It is a non-nucleoside reverse transcriptase inhibitor.
|
Flash Point: | °C |
Safety Data |
Hazard Symbols |
|
|
|