| Identification |
| Name: | 3-Methoxyphenol |
| Synonyms: | m-Hydroxyanisole; 3-Methoxyphenol, (Resorcinol monomethyl ether); Resorcinol monomethyl ether; 3-Hydroxyanisole |
| CAS: | 150-19-6 |
| EINECS: | 205-754-6 |
| Molecular Formula: | C7H8O2 |
| Molecular Weight: | 124.14 |
| InChI: | InChI=1/C7H8O2/c1-9-7-4-2-3-6(8)5-7/h2-5,8H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Flash Point: | 119.1 ºC |
| Density: | 1.131 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.551-1.553 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | Clear, pink to red liquid with the odor of phenol and carmel. |
| Packinggroup: | III |
| HS Code: | 29095090 |
| Flash Point: | 119.1 ºC |
| Storage Temperature: | Store in dark! |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
