| Identification | |
| Name: | Pentanoic acid,5-chloro-5-oxo-, methyl ester |
| Synonyms: | 4-(Chlorocarbonyl)butanoic acidmethyl ester;4-(Methoxycarbonyl)butyryl chloride;4-Chlorocarbonylbutyric acidmethyl ester;5-Chloro-5-oxopentanoic acid methyl ester;Glutaric acidmonomethyl ester chloride;Glutaryl chloride methyl ester;Methyl4-(chlorocarbonyl)butanoate;Methyl 4-(chloroformyl)butanoate;Methyl 5-chloro-5-oxopentanoate;Methyl5-chloro-5-oxovalerate;Methyl glutaroyl chloride;Methyl glutaryl chloride;NSC 93892;g-(Carbomethoxy)butyryl chloride;4-(Carbomethoxy)butanoylchloride;4-(Carbomethoxy)butyryl chloride; |
| CAS: | 1501-26-4 |
| EINECS: | 216-115-6 |
| Molecular Formula: | C6H9ClO3 |
| Molecular Weight: | 164.59 |
| InChI: | InChI=1/C6H9ClO3/c1-10-6(9)4-2-3-5(7)8/h2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.191 |
| Stability: | Stable under normal temperatures and pressures. Moisture sensitive. |
| Refractive index: | 1.4435-1.4455 |
| Water Solubility: | reacts |
| Solubility: | REACTS with water |
| Appearance: | Colorless liquid |
| Specification: |
Methyl 4-(chloroformyl)butyrate (1501-26-4) is clear colourless to light yellow liquid, also known as Methyl glutaryl chloride ; Carbomethoxy butyryl chloride ; Methyl 4-chloroformylbutyrate ; Methyl 5-chloro-5-oxovalerate ; Pentanoic acid, 5-chloro-5-oxo-, methyl ester . It is often used as API intermediate. |
| Packinggroup: | II |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
