Identification |
Name: | 1,3-Dioxolane,2,2-dimethyl-4-[(phenylmethoxy)methyl]- |
Synonyms: | 1,3-Dioxolane,4-[(benzyloxy)methyl]-2,2-dimethyl- (6CI,7CI,8CI);4-(Benzyloxymethyl)-2,2-dimethyl-1,3-dioxolane; NSC 75108 |
CAS: | 15028-56-5 |
EINECS: | 239-110-0 |
Molecular Formula: | C13H18 O3 |
Molecular Weight: | 222.28022 |
InChI: | InChI=1/C13H18O3/c1-13(2)15-10-12(16-13)9-14-8-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 100°C |
Boiling Point: | 300.3°Cat760mmHg |
Density: | 1.039g/cm3 |
Refractive index: | n20/D 1.494(lit.) |
Flash Point: | 100°C |
Storage Temperature: | 2-8°C |
Usage: | Used in the preparation of the analogs of dioxolanes Dexoxadrol and Etoxadrol as potential phencyclidine-like agents. |
Safety Data |
|
|