| Identification | |
| Name: | N-Cyanoacetylmorpholine |
| Synonyms: | 4-(Cyanoacetyl)morpholine; 3-Morpholino-3-oxopropanenitrile |
| CAS: | 15029-32-0 |
| EINECS: | 239-112-1 |
| Molecular Formula: | C7H10N2O2 |
| Molecular Weight: | 154.16 |
| InChI: | InChI=1/C7H10N2O2/c8-5-7(6-10)9-1-3-11-4-2-9/h6-7H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3439 |
| Flash Point: | 93.4°C |
| Boiling Point: | 230.8°Cat760mmHg |
| Density: | 1.173g/cm3 |
| Refractive index: | 1.488 |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Flash Point: | 93.4°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
