| Identification | |
| Name: | Benzoic acid,2-amino-6-fluoro-3-nitro-, ethyl ester |
| Synonyms: | 2AMINO6FLUORO3NITROBENZOICACIDETHYLESTER |
| CAS: | 150368-37-9 |
| Molecular Formula: | C9H9 F N2 O4 |
| Molecular Weight: | 228.18 |
| InChI: | InChI=1/C9H9FN2O4/c1-2-16-9(13)7-5(10)3-4-6(8(7)11)12(14)15/h3-4H,2,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 177.5°C |
| Boiling Point: | 369.9°Cat760mmHg |
| Density: | 1.407g/cm3 |
| Refractive index: | 1.572 |
| Specification: |
The extinguishing agent of 2-Amino-6-fluoro-3-nitrobenzoic acid ethyl ester (CAS No.150368-37-9) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 177.5°C |
| Safety Data | |
 |
|
